C9H11F2N — CID 166468940
3-[(3Z)-3,4-difluorohexa-1,3,5-trien-2-yl]azetidine (PubChem CID 166468940) has the molecular formula C9H11F2N and a molecular weight of 171.19 g/mol. Its IUPAC name is 3-[(3Z)-3,4-difluorohexa-1,3,5-trien-2-yl]azetidine.
| Compound Name | 3-[(3Z)-3,4-difluorohexa-1,3,5-trien-2-yl]azetidine |
|---|---|
| PubChem CID | 166468940 |
| Molecular Formula | C9H11F2N |
| Molecular Weight | 171.19 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 3-[(3Z)-3,4-difluorohexa-1,3,5-trien-2-yl]azetidine |
| SMILES | C=C/C(F)=C(/F)C(=C)C1CNC1 |
| InChI | InChI=1S/C9H11F2N/c1-3-8(10)9(11)6(2)7-4-12-5-7/h3,7,12H,1-2,4-5H2/b9-8- |
| InChIKey | FWPJSSHQEGQQPB-HJWRWDBZSA-N |
| XLogP | 2.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.19 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|