C22H21N3 — CID 166471244
4-[6-[4-(2-methylpropyl)anilino]-3-pyridinyl]benzonitrile (PubChem CID 166471244) has the molecular formula C22H21N3 and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-[6-[4-(2-methylpropyl)anilino]-3-pyridinyl]benzonitrile.
| Compound Name | 4-[6-[4-(2-methylpropyl)anilino]-3-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 166471244 |
| Molecular Formula | C22H21N3 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 4-[6-[4-(2-methylpropyl)anilino]-3-pyridinyl]benzonitrile |
| SMILES | CC(C)Cc1ccc(Nc2ccc(-c3ccc(C#N)cc3)cn2)cc1 |
| InChI | InChI=1S/C22H21N3/c1-16(2)13-17-5-10-21(11-6-17)25-22-12-9-20(15-24-22)19-7-3-18(14-23)4-8-19/h3-12,15-16H,13H2,1-2H3,(H,24,25) |
| InChIKey | OKIMUIFXIQTMST-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |