C18H32N6O4 — CID 166471573
2-[[[4-[4-(4,5-dihydro-1H-imidazol-2-ylamino)butanoyl]piperazine-1-carbonyl]amino]methyl]pentanoic acid (PubChem CID 166471573) has the molecular formula C18H32N6O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-[[[4-[4-(4,5-dihydro-1H-imidazol-2-ylamino)butanoyl]piperazine-1-carbonyl]amino]methyl]pentanoic acid.
| Compound Name | 2-[[[4-[4-(4,5-dihydro-1H-imidazol-2-ylamino)butanoyl]piperazine-1-carbonyl]amino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 166471573 |
| Molecular Formula | C18H32N6O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 2-[[[4-[4-(4,5-dihydro-1H-imidazol-2-ylamino)butanoyl]piperazine-1-carbonyl]amino]methyl]pentanoic acid |
| SMILES | CCCC(CNC(=O)N1CCN(C(=O)CCCNC2=NCCN2)CC1)C(=O)O |
| InChI | InChI=1S/C18H32N6O4/c1-2-4-14(16(26)27)13-22-18(28)24-11-9-23(10-12-24)15(25)5-3-6-19-17-20-7-8-21-17/h14H,2-13H2,1H3,(H,22,28)(H,26,27)(H2,19,20,21) |
| InChIKey | USHMPPKWBGQHDX-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 126.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|