C28H40N2O4 — CID 166472245
ethane;methoxymethylbenzene;methyl 2-cyclohexyl-6-propan-2-yloxyindazole-5-carboxylate (PubChem CID 166472245) has the molecular formula C28H40N2O4 and a molecular weight of 468.64 g/mol. Its IUPAC name is ethane;methoxymethylbenzene;methyl 2-cyclohexyl-6-propan-2-yloxyindazole-5-carboxylate.
| Compound Name | ethane;methoxymethylbenzene;methyl 2-cyclohexyl-6-propan-2-yloxyindazole-5-carboxylate |
|---|---|
| PubChem CID | 166472245 |
| Molecular Formula | C28H40N2O4 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | ethane;methoxymethylbenzene;methyl 2-cyclohexyl-6-propan-2-yloxyindazole-5-carboxylate |
| SMILES | CC.COC(=O)c1cc2cn(C3CCCCC3)nc2cc1OC(C)C.COCc1ccccc1 |
| InChI | InChI=1S/C18H24N2O3.C8H10O.C2H6/c1-12(2)23-17-10-16-13(9-15(17)18(21)22-3)11-20(19-16)14-7-5-4-6-8-14;1-9-7-8-5-3-2-4-6-8;1-2/h9-12,14H,4-8H2,1-3H3;2-6H,7H2,1H3;1-2H3 |
| InChIKey | BUHXDLBIKYLKMK-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |