About 1-methyl-5-[(1Z)-3-methylbuta-1,3-dienyl]pyrazole
1-methyl-5-[(1Z)-3-methylbuta-1,3-dienyl]pyrazole (PubChem CID 166472401) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 1-methyl-5-[(1Z)-3-methylbuta-1,3-dienyl]pyrazole.
Molecular Properties
| Compound Name | 1-methyl-5-[(1Z)-3-methylbuta-1,3-dienyl]pyrazole |
| PubChem CID | 166472401 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 1-methyl-5-[(1Z)-3-methylbuta-1,3-dienyl]pyrazole |
| SMILES | C=C(C)/C=C\c1ccnn1C |
| InChI | InChI=1S/C9H12N2/c1-8(2)4-5-9-6-7-10-11(9)3/h4-7H,1H2,2-3H3/b5-4- |
| InChIKey | LTTHUUCTQOYIFX-PLNGDYQASA-N |
| XLogP | 2.01 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-5-[(1Z)-3-methylbuta-1,3-dienyl]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-[(1Z)-3-methylbuta-1,3-dienyl]pyrazole?
The IUPAC name of 1-methyl-5-[(1Z)-3-methylbuta-1,3-dienyl]pyrazole (CID 166472401) is 1-methyl-5-[(1Z)-3-methylbuta-1,3-dienyl]pyrazole.
What is the SMILES notation for 1-methyl-5-[(1Z)-3-methylbuta-1,3-dienyl]pyrazole?
The canonical SMILES for 1-methyl-5-[(1Z)-3-methylbuta-1,3-dienyl]pyrazole is C=C(C)/C=C\c1ccnn1C.
What is the InChIKey of 1-methyl-5-[(1Z)-3-methylbuta-1,3-dienyl]pyrazole?
The InChIKey is LTTHUUCTQOYIFX-PLNGDYQASA-N. The full InChI is InChI=1S/C9H12N2/c1-8(2)4-5-9-6-7-10-11(9)3/h4-7H,1H2,2-3H3/b5-4-.
What are the key properties of 1-methyl-5-[(1Z)-3-methylbuta-1,3-dienyl]pyrazole?
1-methyl-5-[(1Z)-3-methylbuta-1,3-dienyl]pyrazole has a molecular weight of 148.21 g/mol, XLogP of 2.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-[(1Z)-3-methylbuta-1,3-dienyl]pyrazole is sourced from PubChem (CID 166472401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).