C56H76FGaN12O14Si — CID 166472461
CID 166472461 (PubChem CID 166472461) has the molecular formula C56H76FGaN12O14Si and a molecular weight of 1258.10 g/mol.
| Compound Name | CID 166472461 |
|---|---|
| PubChem CID | 166472461 |
| Molecular Formula | C56H76FGaN12O14Si |
| Molecular Weight | 1258.10 g/mol |
| Exact Mass | 1256.46 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si](F)(c1ccc(C(=O)NC[C@@H](NC(=O)CC[C@H](C(=O)O)N2CCN3CCN(CC(=O)O[Ga])CCN(CC2)CC(=O)OOC(=O)C3)C(=O)NCCCOc2ccc3ncnc(C(=O)NCC(=O)N4CCC[C@H]4C#N)c3c2)cc1)C(C)(C)C |
| InChI | InChI=1S/C56H77FN12O14Si.Ga/c1-55(2,3)84(57,56(4,5)6)40-13-10-37(11-14-40)51(76)60-31-43(52(77)59-18-8-28-81-39-12-15-42-41(29-39)50(63-36-62-42)53(78)61-32-46(71)69-19-7-9-38(69)30-58)64-45(70)17-16-44(54(79)80)68-26-24-66-22-20-65(33-47(72)73)21-23-67(25-27-68)35-49(75)83-82-48(74)34-66;/h10-15,29,36,38,43-44H,7-9,16-28,31-35H2,1-6H3,(H,59,77)(H,60,76)(H,61,78)(H,64,70)(H,72,73)(H,79,80);/q;+1/p-1/t38-,43+,44+;/m0./s1 |
| InChIKey | FIXFOYAISHDHBJ-QIXUPBHLSA-M |
| XLogP | 0.49 |
| TPSA | 324.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1258.10 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|