About 6-(1,1-difluoroethyl)-1-methylpyrimidine-2,4-dione
6-(1,1-difluoroethyl)-1-methylpyrimidine-2,4-dione (PubChem CID 166473593) has the molecular formula C7H8F2N2O2
and a molecular weight of 190.15 g/mol. Its IUPAC name is 6-(1,1-difluoroethyl)-1-methylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-(1,1-difluoroethyl)-1-methylpyrimidine-2,4-dione |
| PubChem CID | 166473593 |
| Molecular Formula | C7H8F2N2O2 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 6-(1,1-difluoroethyl)-1-methylpyrimidine-2,4-dione |
| SMILES | Cn1c(C(C)(F)F)cc(=O)[nH]c1=O |
| InChI | InChI=1S/C7H8F2N2O2/c1-7(8,9)4-3-5(12)10-6(13)11(4)2/h3H,1-2H3,(H,10,12,13) |
| InChIKey | HTVWBQFJIFCBKR-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(1,1-difluoroethyl)-1-methylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1,1-difluoroethyl)-1-methylpyrimidine-2,4-dione?
The IUPAC name of 6-(1,1-difluoroethyl)-1-methylpyrimidine-2,4-dione (CID 166473593) is 6-(1,1-difluoroethyl)-1-methylpyrimidine-2,4-dione.
What is the SMILES notation for 6-(1,1-difluoroethyl)-1-methylpyrimidine-2,4-dione?
The canonical SMILES for 6-(1,1-difluoroethyl)-1-methylpyrimidine-2,4-dione is Cn1c(C(C)(F)F)cc(=O)[nH]c1=O.
What is the InChIKey of 6-(1,1-difluoroethyl)-1-methylpyrimidine-2,4-dione?
The InChIKey is HTVWBQFJIFCBKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2N2O2/c1-7(8,9)4-3-5(12)10-6(13)11(4)2/h3H,1-2H3,(H,10,12,13).
What are the key properties of 6-(1,1-difluoroethyl)-1-methylpyrimidine-2,4-dione?
6-(1,1-difluoroethyl)-1-methylpyrimidine-2,4-dione has a molecular weight of 190.15 g/mol, XLogP of 0.19, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1,1-difluoroethyl)-1-methylpyrimidine-2,4-dione is sourced from PubChem (CID 166473593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).