C18H20F5N3O6S — CID 166473811
[2,3-difluoro-4-[1-(2-methoxyethyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazol-4-yl]phenyl] trifluoromethanesulfonate (PubChem CID 166473811) has the molecular formula C18H20F5N3O6S and a molecular weight of 501.43 g/mol. Its IUPAC name is [2,3-difluoro-4-[1-(2-methoxyethyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazol-4-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [2,3-difluoro-4-[1-(2-methoxyethyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazol-4-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 166473811 |
| Molecular Formula | C18H20F5N3O6S |
| Molecular Weight | 501.43 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | [2,3-difluoro-4-[1-(2-methoxyethyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pyrazol-4-yl]phenyl] trifluoromethanesulfonate |
| SMILES | COCCn1cc(-c2ccc(OS(=O)(=O)C(F)(F)F)c(F)c2F)c(NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C18H20F5N3O6S/c1-17(2,3)31-16(27)24-15-11(9-26(25-15)7-8-30-4)10-5-6-12(14(20)13(10)19)32-33(28,29)18(21,22)23/h5-6,9H,7-8H2,1-4H3,(H,24,25,27) |
| InChIKey | RTXNYVZUTNYCOR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|