C14H25N4O+ — CID 166473847
N-(1,1-dimethylpiperidin-1-ium-3-yl)-2-(3,4-dimethylpyrazol-1-yl)acetamide (PubChem CID 166473847) has the molecular formula C14H25N4O+ and a molecular weight of 265.38 g/mol. Its IUPAC name is N-(1,1-dimethylpiperidin-1-ium-3-yl)-2-(3,4-dimethylpyrazol-1-yl)acetamide.
| Compound Name | N-(1,1-dimethylpiperidin-1-ium-3-yl)-2-(3,4-dimethylpyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 166473847 |
| Molecular Formula | C14H25N4O+ |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | N-(1,1-dimethylpiperidin-1-ium-3-yl)-2-(3,4-dimethylpyrazol-1-yl)acetamide |
| SMILES | Cc1cn(CC(=O)NC2CCC[N+](C)(C)C2)nc1C |
| InChI | InChI=1S/C14H24N4O/c1-11-8-17(16-12(11)2)9-14(19)15-13-6-5-7-18(3,4)10-13/h8,13H,5-7,9-10H2,1-4H3/p+1 |
| InChIKey | DEFQPYOFCSARKG-UHFFFAOYSA-O |
| XLogP | 0.85 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|