C13H19F2N3O — CID 166473915
N-(4,4-difluorocyclohexyl)-2-(3,4-dimethylpyrazol-1-yl)acetamide (PubChem CID 166473915) has the molecular formula C13H19F2N3O and a molecular weight of 271.31 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-2-(3,4-dimethylpyrazol-1-yl)acetamide.
| Compound Name | N-(4,4-difluorocyclohexyl)-2-(3,4-dimethylpyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 166473915 |
| Molecular Formula | C13H19F2N3O |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-2-(3,4-dimethylpyrazol-1-yl)acetamide |
| SMILES | Cc1cn(CC(=O)NC2CCC(F)(F)CC2)nc1C |
| InChI | InChI=1S/C13H19F2N3O/c1-9-7-18(17-10(9)2)8-12(19)16-11-3-5-13(14,15)6-4-11/h7,11H,3-6,8H2,1-2H3,(H,16,19) |
| InChIKey | YYEOYAYGTWLZQY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |