C19H27BFN3O3 — CID 166473972
2-fluoro-6-[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 166473972) has the molecular formula C19H27BFN3O3 and a molecular weight of 375.25 g/mol. Its IUPAC name is 2-fluoro-6-[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 2-fluoro-6-[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 166473972 |
| Molecular Formula | C19H27BFN3O3 |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 2-fluoro-6-[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | COCCn1nc(C)c(-c2ccc(B3OC(C)(C)C(C)(C)O3)c(F)n2)c1C |
| InChI | InChI=1S/C19H27BFN3O3/c1-12-16(13(2)24(23-12)10-11-25-7)15-9-8-14(17(21)22-15)20-26-18(3,4)19(5,6)27-20/h8-9H,10-11H2,1-7H3 |
| InChIKey | RRPRNXQNHQVAHZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|