About tert-butyl N-[4-(2,3-difluoro-4-phenylmethoxyphenyl)-1-(2-methoxyethyl)pyrazol-3-yl]carbamate
tert-butyl N-[4-(2,3-difluoro-4-phenylmethoxyphenyl)-1-(2-methoxyethyl)pyrazol-3-yl]carbamate (PubChem CID 166474087) has the molecular formula C24H27F2N3O4
and a molecular weight of 459.49 g/mol. Its IUPAC name is tert-butyl N-[4-(2,3-difluoro-4-phenylmethoxyphenyl)-1-(2-methoxyethyl)pyrazol-3-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[4-(2,3-difluoro-4-phenylmethoxyphenyl)-1-(2-methoxyethyl)pyrazol-3-yl]carbamate |
| PubChem CID | 166474087 |
| Molecular Formula | C24H27F2N3O4 |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | tert-butyl N-[4-(2,3-difluoro-4-phenylmethoxyphenyl)-1-(2-methoxyethyl)pyrazol-3-yl]carbamate |
| SMILES | COCCn1cc(-c2ccc(OCc3ccccc3)c(F)c2F)c(NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C24H27F2N3O4/c1-24(2,3)33-23(30)27-22-18(14-29(28-22)12-13-31-4)17-10-11-19(21(26)20(17)25)32-15-16-8-6-5-7-9-16/h5-11,14H,12-13,15H2,1-4H3,(H,27,28,30) |
| InChIKey | NEYOFAHAFLHDQN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[4-(2,3-difluoro-4-phenylmethoxyphenyl)-1-(2-methoxyethyl)pyrazol-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[4-(2,3-difluoro-4-phenylmethoxyphenyl)-1-(2-methoxyethyl)pyrazol-3-yl]carbamate?
The IUPAC name of tert-butyl N-[4-(2,3-difluoro-4-phenylmethoxyphenyl)-1-(2-methoxyethyl)pyrazol-3-yl]carbamate (CID 166474087) is tert-butyl N-[4-(2,3-difluoro-4-phenylmethoxyphenyl)-1-(2-methoxyethyl)pyrazol-3-yl]carbamate.
What is the SMILES notation for tert-butyl N-[4-(2,3-difluoro-4-phenylmethoxyphenyl)-1-(2-methoxyethyl)pyrazol-3-yl]carbamate?
The canonical SMILES for tert-butyl N-[4-(2,3-difluoro-4-phenylmethoxyphenyl)-1-(2-methoxyethyl)pyrazol-3-yl]carbamate is COCCn1cc(-c2ccc(OCc3ccccc3)c(F)c2F)c(NC(=O)OC(C)(C)C)n1.
What is the InChIKey of tert-butyl N-[4-(2,3-difluoro-4-phenylmethoxyphenyl)-1-(2-methoxyethyl)pyrazol-3-yl]carbamate?
The InChIKey is NEYOFAHAFLHDQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27F2N3O4/c1-24(2,3)33-23(30)27-22-18(14-29(28-22)12-13-31-4)17-10-11-19(21(26)20(17)25)32-15-16-8-6-5-7-9-16/h5-11,14H,12-13,15H2,1-4H3,(H,27,28,30).
What are the key properties of tert-butyl N-[4-(2,3-difluoro-4-phenylmethoxyphenyl)-1-(2-methoxyethyl)pyrazol-3-yl]carbamate?
tert-butyl N-[4-(2,3-difluoro-4-phenylmethoxyphenyl)-1-(2-methoxyethyl)pyrazol-3-yl]carbamate has a molecular weight of 459.49 g/mol, XLogP of 5.40, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[4-(2,3-difluoro-4-phenylmethoxyphenyl)-1-(2-methoxyethyl)pyrazol-3-yl]carbamate is sourced from PubChem (CID 166474087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).