C13H9F5N2O3S — CID 166474572
[4-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)-2,3-difluorophenyl] trifluoromethanesulfonate (PubChem CID 166474572) has the molecular formula C13H9F5N2O3S and a molecular weight of 368.28 g/mol. Its IUPAC name is [4-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)-2,3-difluorophenyl] trifluoromethanesulfonate.
| Compound Name | [4-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)-2,3-difluorophenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 166474572 |
| Molecular Formula | C13H9F5N2O3S |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | [4-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-3-yl)-2,3-difluorophenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(-c2cnn3c2CCC3)c(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C13H9F5N2O3S/c14-11-7(8-6-19-20-5-1-2-9(8)20)3-4-10(12(11)15)23-24(21,22)13(16,17)18/h3-4,6H,1-2,5H2 |
| InChIKey | HZJIWVSYPXMAGR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|