C19H25BF2N4O2 — CID 166474655
(Z)-3-[4-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-methylpyrazol-1-yl]prop-1-ene-1,2-diamine (PubChem CID 166474655) has the molecular formula C19H25BF2N4O2 and a molecular weight of 390.24 g/mol. Its IUPAC name is (Z)-3-[4-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-methylpyrazol-1-yl]prop-1-ene-1,2-diamine.
| Compound Name | (Z)-3-[4-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-methylpyrazol-1-yl]prop-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 166474655 |
| Molecular Formula | C19H25BF2N4O2 |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | (Z)-3-[4-[2,3-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3-methylpyrazol-1-yl]prop-1-ene-1,2-diamine |
| SMILES | Cc1nn(C/C(N)=C/N)cc1-c1ccc(B2OC(C)(C)C(C)(C)O2)c(F)c1F |
| InChI | InChI=1S/C19H25BF2N4O2/c1-11-14(10-26(25-11)9-12(24)8-23)13-6-7-15(17(22)16(13)21)20-27-18(2,3)19(4,5)28-20/h6-8,10H,9,23-24H2,1-5H3/b12-8- |
| InChIKey | SZUYHAOYFHHRKX-WQLSENKSSA-N |
| XLogP | 2.19 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|