About ethane;1-(4-methyl-7-propylcyclohepta-2,4-dien-1-yl)propan-1-one
ethane;1-(4-methyl-7-propylcyclohepta-2,4-dien-1-yl)propan-1-one (PubChem CID 166474742) has the molecular formula C16H28O
and a molecular weight of 236.40 g/mol. Its IUPAC name is ethane;1-(4-methyl-7-propylcyclohepta-2,4-dien-1-yl)propan-1-one.
Molecular Properties
| Compound Name | ethane;1-(4-methyl-7-propylcyclohepta-2,4-dien-1-yl)propan-1-one |
| PubChem CID | 166474742 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | ethane;1-(4-methyl-7-propylcyclohepta-2,4-dien-1-yl)propan-1-one |
| SMILES | CC.CCCC1CC=C(C)C=CC1C(=O)CC |
| InChI | InChI=1S/C14H22O.C2H6/c1-4-6-12-9-7-11(3)8-10-13(12)14(15)5-2;1-2/h7-8,10,12-13H,4-6,9H2,1-3H3;1-2H3 |
| InChIKey | OFHYZTDWRQLSGL-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-(4-methyl-7-propylcyclohepta-2,4-dien-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(4-methyl-7-propylcyclohepta-2,4-dien-1-yl)propan-1-one?
The IUPAC name of ethane;1-(4-methyl-7-propylcyclohepta-2,4-dien-1-yl)propan-1-one (CID 166474742) is ethane;1-(4-methyl-7-propylcyclohepta-2,4-dien-1-yl)propan-1-one.
What is the SMILES notation for ethane;1-(4-methyl-7-propylcyclohepta-2,4-dien-1-yl)propan-1-one?
The canonical SMILES for ethane;1-(4-methyl-7-propylcyclohepta-2,4-dien-1-yl)propan-1-one is CC.CCCC1CC=C(C)C=CC1C(=O)CC.
What is the InChIKey of ethane;1-(4-methyl-7-propylcyclohepta-2,4-dien-1-yl)propan-1-one?
The InChIKey is OFHYZTDWRQLSGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O.C2H6/c1-4-6-12-9-7-11(3)8-10-13(12)14(15)5-2;1-2/h7-8,10,12-13H,4-6,9H2,1-3H3;1-2H3.
What are the key properties of ethane;1-(4-methyl-7-propylcyclohepta-2,4-dien-1-yl)propan-1-one?
ethane;1-(4-methyl-7-propylcyclohepta-2,4-dien-1-yl)propan-1-one has a molecular weight of 236.40 g/mol, XLogP of 4.93, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(4-methyl-7-propylcyclohepta-2,4-dien-1-yl)propan-1-one is sourced from PubChem (CID 166474742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).