About rhenium;(NE)-N-(3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine
rhenium;(NE)-N-(3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine (PubChem CID 166475473) has the molecular formula C10H11NORe
and a molecular weight of 347.41 g/mol. Its IUPAC name is rhenium;(NE)-N-(3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine.
Molecular Properties
| Compound Name | rhenium;(NE)-N-(3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine |
| PubChem CID | 166475473 |
| Molecular Formula | C10H11NORe |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | rhenium;(NE)-N-(3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine |
| SMILES | O/N=C1\C=CC2C3C=CC(C3)C12.[Re] |
| InChI | InChI=1S/C10H11NO.Re/c12-11-9-4-3-8-6-1-2-7(5-6)10(8)9;/h1-4,6-8,10,12H,5H2;/b11-9+; |
| InChIKey | OQCCDFGARHMMLN-LBEJWNQZSA-N |
| XLogP | 1.82 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze rhenium;(NE)-N-(3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of rhenium;(NE)-N-(3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine?
The IUPAC name of rhenium;(NE)-N-(3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine (CID 166475473) is rhenium;(NE)-N-(3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine.
What is the SMILES notation for rhenium;(NE)-N-(3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine?
The canonical SMILES for rhenium;(NE)-N-(3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine is O/N=C1\C=CC2C3C=CC(C3)C12.[Re].
What is the InChIKey of rhenium;(NE)-N-(3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine?
The InChIKey is OQCCDFGARHMMLN-LBEJWNQZSA-N. The full InChI is InChI=1S/C10H11NO.Re/c12-11-9-4-3-8-6-1-2-7(5-6)10(8)9;/h1-4,6-8,10,12H,5H2;/b11-9+;.
What are the key properties of rhenium;(NE)-N-(3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine?
rhenium;(NE)-N-(3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine has a molecular weight of 347.41 g/mol, XLogP of 1.82, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for rhenium;(NE)-N-(3-tricyclo[5.2.1.02,6]deca-4,8-dienylidene)hydroxylamine is sourced from PubChem (CID 166475473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).