About 1,7-dimethylpyrrolo[2,3-c]pyridine-2-carbaldehyde;methanol
1,7-dimethylpyrrolo[2,3-c]pyridine-2-carbaldehyde;methanol (PubChem CID 166476022) has the molecular formula C11H14N2O2
and a molecular weight of 206.24 g/mol. Its IUPAC name is 1,7-dimethylpyrrolo[2,3-c]pyridine-2-carbaldehyde;methanol.
Molecular Properties
| Compound Name | 1,7-dimethylpyrrolo[2,3-c]pyridine-2-carbaldehyde;methanol |
| PubChem CID | 166476022 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1,7-dimethylpyrrolo[2,3-c]pyridine-2-carbaldehyde;methanol |
| SMILES | CO.Cc1nccc2cc(C=O)n(C)c12 |
| InChI | InChI=1S/C10H10N2O.CH4O/c1-7-10-8(3-4-11-7)5-9(6-13)12(10)2;1-2/h3-6H,1-2H3;2H,1H3 |
| InChIKey | KSFOXHUFJMTAMV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1,7-dimethylpyrrolo[2,3-c]pyridine-2-carbaldehyde;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-dimethylpyrrolo[2,3-c]pyridine-2-carbaldehyde;methanol?
The IUPAC name of 1,7-dimethylpyrrolo[2,3-c]pyridine-2-carbaldehyde;methanol (CID 166476022) is 1,7-dimethylpyrrolo[2,3-c]pyridine-2-carbaldehyde;methanol.
What is the SMILES notation for 1,7-dimethylpyrrolo[2,3-c]pyridine-2-carbaldehyde;methanol?
The canonical SMILES for 1,7-dimethylpyrrolo[2,3-c]pyridine-2-carbaldehyde;methanol is CO.Cc1nccc2cc(C=O)n(C)c12.
What is the InChIKey of 1,7-dimethylpyrrolo[2,3-c]pyridine-2-carbaldehyde;methanol?
The InChIKey is KSFOXHUFJMTAMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O.CH4O/c1-7-10-8(3-4-11-7)5-9(6-13)12(10)2;1-2/h3-6H,1-2H3;2H,1H3.
What are the key properties of 1,7-dimethylpyrrolo[2,3-c]pyridine-2-carbaldehyde;methanol?
1,7-dimethylpyrrolo[2,3-c]pyridine-2-carbaldehyde;methanol has a molecular weight of 206.24 g/mol, XLogP of 1.30, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dimethylpyrrolo[2,3-c]pyridine-2-carbaldehyde;methanol is sourced from PubChem (CID 166476022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).