C24H26F3N5O6 — CID 166476367
2-[[7-methoxy-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]-6-[(3S)-oxolan-3-yl]oxyquinazolin-2-yl]amino]ethanol (PubChem CID 166476367) has the molecular formula C24H26F3N5O6 and a molecular weight of 537.50 g/mol. Its IUPAC name is 2-[[7-methoxy-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]-6-[(3S)-oxolan-3-yl]oxyquinazolin-2-yl]amino]ethanol.
| Compound Name | 2-[[7-methoxy-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]-6-[(3S)-oxolan-3-yl]oxyquinazolin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 166476367 |
| Molecular Formula | C24H26F3N5O6 |
| Molecular Weight | 537.50 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | 2-[[7-methoxy-4-[[(1R)-1-[3-nitro-5-(trifluoromethyl)phenyl]ethyl]amino]-6-[(3S)-oxolan-3-yl]oxyquinazolin-2-yl]amino]ethanol |
| SMILES | COc1cc2nc(NCCO)nc(N[C@H](C)c3cc([N+](=O)[O-])cc(C(F)(F)F)c3)c2cc1O[C@H]1CCOC1 |
| InChI | InChI=1S/C24H26F3N5O6/c1-13(14-7-15(24(25,26)27)9-16(8-14)32(34)35)29-22-18-10-21(38-17-3-6-37-12-17)20(36-2)11-19(18)30-23(31-22)28-4-5-33/h7-11,13,17,33H,3-6,12H2,1-2H3,(H2,28,29,30,31)/t13-,17+/m1/s1 |
| InChIKey | PDHGJCIBIQFOMP-DYVFJYSZSA-N |
| XLogP | 4.31 |
| TPSA | 140.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|