C24H28F3N7O2 — CID 166476385
[7-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-12-propan-2-yl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(3-methyloxetan-3-yl)methanone (PubChem CID 166476385) has the molecular formula C24H28F3N7O2 and a molecular weight of 503.53 g/mol. Its IUPAC name is [7-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-12-propan-2-yl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(3-methyloxetan-3-yl)methanone.
| Compound Name | [7-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-12-propan-2-yl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(3-methyloxetan-3-yl)methanone |
|---|---|
| PubChem CID | 166476385 |
| Molecular Formula | C24H28F3N7O2 |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | [7-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]ethyl]amino]-12-propan-2-yl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(3-methyloxetan-3-yl)methanone |
| SMILES | CC(C)c1nnc2nc(N[C@H](C)c3cc(N)cc(C(F)(F)F)c3)c3c(n12)CN(C(=O)C1(C)COC1)C3 |
| InChI | InChI=1S/C24H28F3N7O2/c1-12(2)20-31-32-22-30-19(29-13(3)14-5-15(24(25,26)27)7-16(28)6-14)17-8-33(9-18(17)34(20)22)21(35)23(4)10-36-11-23/h5-7,12-13H,8-11,28H2,1-4H3,(H,29,30,32)/t13-/m1/s1 |
| InChIKey | YSSDPWGYAHURKI-CYBMUJFWSA-N |
| XLogP | 3.90 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|