C25H29F3N6O3 — CID 166476534
[7-[[5-amino-2-methyl-3-(trifluoromethyl)phenyl]methylamino]-12-methyl-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(4-methoxyoxan-4-yl)methanone (PubChem CID 166476534) has the molecular formula C25H29F3N6O3 and a molecular weight of 518.54 g/mol. Its IUPAC name is [7-[[5-amino-2-methyl-3-(trifluoromethyl)phenyl]methylamino]-12-methyl-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(4-methoxyoxan-4-yl)methanone.
| Compound Name | [7-[[5-amino-2-methyl-3-(trifluoromethyl)phenyl]methylamino]-12-methyl-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(4-methoxyoxan-4-yl)methanone |
|---|---|
| PubChem CID | 166476534 |
| Molecular Formula | C25H29F3N6O3 |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | [7-[[5-amino-2-methyl-3-(trifluoromethyl)phenyl]methylamino]-12-methyl-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(4-methoxyoxan-4-yl)methanone |
| SMILES | COC1(C(=O)N2Cc3c(NCc4cc(N)cc(C(F)(F)F)c4C)nc4ncc(C)n4c3C2)CCOCC1 |
| InChI | InChI=1S/C25H29F3N6O3/c1-14-10-31-23-32-21(30-11-16-8-17(29)9-19(15(16)2)25(26,27)28)18-12-33(13-20(18)34(14)23)22(35)24(36-3)4-6-37-7-5-24/h8-10H,4-7,11-13,29H2,1-3H3,(H,30,31,32) |
| InChIKey | IVJYNXLOWZGZOM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 107.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|