C26H28F3N7O3 — CID 166476601
methyl (2S)-4-[7-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-12-methyl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-4-carbonyl]bicyclo[2.1.1]hexane-2-carboxylate (PubChem CID 166476601) has the molecular formula C26H28F3N7O3 and a molecular weight of 543.55 g/mol. Its IUPAC name is methyl (2S)-4-[7-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-12-methyl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-4-carbonyl]bicyclo[2.1.1]hexane-2-carboxylate.
| Compound Name | methyl (2S)-4-[7-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-12-methyl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-4-carbonyl]bicyclo[2.1.1]hexane-2-carboxylate |
|---|---|
| PubChem CID | 166476601 |
| Molecular Formula | C26H28F3N7O3 |
| Molecular Weight | 543.55 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | methyl (2S)-4-[7-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-12-methyl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-4-carbonyl]bicyclo[2.1.1]hexane-2-carboxylate |
| SMILES | COC(=O)[C@H]1CC2(C(=O)N3Cc4c(NC(C)c5cc(N)cc(C(F)(F)F)c5)nc5nnc(C)n5c4C3)CC1C2 |
| InChI | InChI=1S/C26H28F3N7O3/c1-12(14-4-16(26(27,28)29)6-17(30)5-14)31-21-19-10-35(11-20(19)36-13(2)33-34-24(36)32-21)23(38)25-7-15(8-25)18(9-25)22(37)39-3/h4-6,12,15,18H,7-11,30H2,1-3H3,(H,31,32,34)/t12?,15?,18-,25?/m0/s1 |
| InChIKey | BOIRIMCXBSOHDZ-VRSUIFFBSA-N |
| XLogP | 3.64 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|