C25H27F3N6O — CID 166476610
acetylene;[7-[1-[3-(difluoromethyl)-2-fluorophenyl]ethylamino]-12-methyl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(2-methylcyclobutyl)methanone (PubChem CID 166476610) has the molecular formula C25H27F3N6O and a molecular weight of 484.53 g/mol. Its IUPAC name is acetylene;[7-[1-[3-(difluoromethyl)-2-fluorophenyl]ethylamino]-12-methyl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(2-methylcyclobutyl)methanone.
| Compound Name | acetylene;[7-[1-[3-(difluoromethyl)-2-fluorophenyl]ethylamino]-12-methyl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(2-methylcyclobutyl)methanone |
|---|---|
| PubChem CID | 166476610 |
| Molecular Formula | C25H27F3N6O |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | acetylene;[7-[1-[3-(difluoromethyl)-2-fluorophenyl]ethylamino]-12-methyl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(2-methylcyclobutyl)methanone |
| SMILES | C#C.Cc1nnc2nc(NC(C)c3cccc(C(F)F)c3F)c3c(n12)CN(C(=O)C1CCC1C)C3 |
| InChI | InChI=1S/C23H25F3N6O.C2H2/c1-11-7-8-14(11)22(33)31-9-17-18(10-31)32-13(3)29-30-23(32)28-21(17)27-12(2)15-5-4-6-16(19(15)24)20(25)26;1-2/h4-6,11-12,14,20H,7-10H2,1-3H3,(H,27,28,30);1-2H |
| InChIKey | LVHBJTOAGDHBCV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|