C22H23F3N6O2 — CID 166476646
[7-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(1-methoxycyclopropyl)methanone (PubChem CID 166476646) has the molecular formula C22H23F3N6O2 and a molecular weight of 460.46 g/mol. Its IUPAC name is [7-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(1-methoxycyclopropyl)methanone.
| Compound Name | [7-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(1-methoxycyclopropyl)methanone |
|---|---|
| PubChem CID | 166476646 |
| Molecular Formula | C22H23F3N6O2 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | [7-[1-[3-amino-5-(trifluoromethyl)phenyl]ethylamino]-1,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-(1-methoxycyclopropyl)methanone |
| SMILES | COC1(C(=O)N2Cc3c(NC(C)c4cc(N)cc(C(F)(F)F)c4)nc4nccn4c3C2)CC1 |
| InChI | InChI=1S/C22H23F3N6O2/c1-12(13-7-14(22(23,24)25)9-15(26)8-13)28-18-16-10-30(19(32)21(33-2)3-4-21)11-17(16)31-6-5-27-20(31)29-18/h5-9,12H,3-4,10-11,26H2,1-2H3,(H,27,28,29) |
| InChIKey | CIONECZZZACHAO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|