C23H27F3N8O2 — CID 166476672
[7-[[3-amino-5-(trifluoromethyl)phenyl]methylamino]-12-propan-2-yl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-morpholin-4-ylmethanone (PubChem CID 166476672) has the molecular formula C23H27F3N8O2 and a molecular weight of 504.52 g/mol. Its IUPAC name is [7-[[3-amino-5-(trifluoromethyl)phenyl]methylamino]-12-propan-2-yl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [7-[[3-amino-5-(trifluoromethyl)phenyl]methylamino]-12-propan-2-yl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 166476672 |
| Molecular Formula | C23H27F3N8O2 |
| Molecular Weight | 504.52 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | [7-[[3-amino-5-(trifluoromethyl)phenyl]methylamino]-12-propan-2-yl-1,4,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl]-morpholin-4-ylmethanone |
| SMILES | CC(C)c1nnc2nc(NCc3cc(N)cc(C(F)(F)F)c3)c3c(n12)CN(C(=O)N1CCOCC1)C3 |
| InChI | InChI=1S/C23H27F3N8O2/c1-13(2)20-30-31-21-29-19(28-10-14-7-15(23(24,25)26)9-16(27)8-14)17-11-33(12-18(17)34(20)21)22(35)32-3-5-36-6-4-32/h7-9,13H,3-6,10-12,27H2,1-2H3,(H,28,29,31) |
| InChIKey | DWBKFAHQEZAVJV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|