C26H27NO7 — CID 16647708
diethyl 2-(4-ethoxycarbonylphenyl)-1,3-dimethyl-6-oxocyclohepta[c]pyrrole-5,7-dicarboxylate (PubChem CID 16647708) has the molecular formula C26H27NO7 and a molecular weight of 465.50 g/mol. Its IUPAC name is diethyl 2-(4-ethoxycarbonylphenyl)-1,3-dimethyl-6-oxocyclohepta[c]pyrrole-5,7-dicarboxylate.
| Compound Name | diethyl 2-(4-ethoxycarbonylphenyl)-1,3-dimethyl-6-oxocyclohepta[c]pyrrole-5,7-dicarboxylate |
|---|---|
| PubChem CID | 16647708 |
| Molecular Formula | C26H27NO7 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | diethyl 2-(4-ethoxycarbonylphenyl)-1,3-dimethyl-6-oxocyclohepta[c]pyrrole-5,7-dicarboxylate |
| SMILES | CCOC(=O)c1ccc(-n2c(C)c3cc(C(=O)OCC)c(=O)c(C(=O)OCC)cc3c2C)cc1 |
| InChI | InChI=1S/C26H27NO7/c1-6-32-24(29)17-9-11-18(12-10-17)27-15(4)19-13-21(25(30)33-7-2)23(28)22(26(31)34-8-3)14-20(19)16(27)5/h9-14H,6-8H2,1-5H3 |
| InChIKey | SUSWZQDHINYHQX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|