C27H28F2N8O2 — CID 166477692
4-N-[2-(dimethylamino)ethyl]-4-N-ethyl-2-fluoro-1-N-[4-(4-fluoro-1-methylindol-3-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]-5-nitrobenzene-1,4-diamine (PubChem CID 166477692) has the molecular formula C27H28F2N8O2 and a molecular weight of 534.57 g/mol. Its IUPAC name is 4-N-[2-(dimethylamino)ethyl]-4-N-ethyl-2-fluoro-1-N-[4-(4-fluoro-1-methylindol-3-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]-5-nitrobenzene-1,4-diamine.
| Compound Name | 4-N-[2-(dimethylamino)ethyl]-4-N-ethyl-2-fluoro-1-N-[4-(4-fluoro-1-methylindol-3-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]-5-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 166477692 |
| Molecular Formula | C27H28F2N8O2 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | 4-N-[2-(dimethylamino)ethyl]-4-N-ethyl-2-fluoro-1-N-[4-(4-fluoro-1-methylindol-3-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]-5-nitrobenzene-1,4-diamine |
| SMILES | CCN(CCN(C)C)c1cc(F)c(Nc2nc(-c3cn(C)c4cccc(F)c34)c3cc[nH]c3n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H28F2N8O2/c1-5-36(12-11-34(2)3)22-13-19(29)20(14-23(22)37(38)39)31-27-32-25(16-9-10-30-26(16)33-27)17-15-35(4)21-8-6-7-18(28)24(17)21/h6-10,13-15H,5,11-12H2,1-4H3,(H2,30,31,32,33) |
| InChIKey | PTYNZJGFCOLWKO-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 108.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|