About 4-butan-2-yl-2,3-dihydroisoindol-1-one;molecular hydrogen
4-butan-2-yl-2,3-dihydroisoindol-1-one;molecular hydrogen (PubChem CID 166478199) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 4-butan-2-yl-2,3-dihydroisoindol-1-one;molecular hydrogen.
Molecular Properties
| Compound Name | 4-butan-2-yl-2,3-dihydroisoindol-1-one;molecular hydrogen |
| PubChem CID | 166478199 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 4-butan-2-yl-2,3-dihydroisoindol-1-one;molecular hydrogen |
| SMILES | CCC(C)c1cccc2c1CNC2=O.[H][H] |
| InChI | InChI=1S/C12H15NO.H2/c1-3-8(2)9-5-4-6-10-11(9)7-13-12(10)14;/h4-6,8H,3,7H2,1-2H3,(H,13,14);1H |
| InChIKey | JTHOMGIZVHZHCD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-butan-2-yl-2,3-dihydroisoindol-1-one;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-yl-2,3-dihydroisoindol-1-one;molecular hydrogen?
The IUPAC name of 4-butan-2-yl-2,3-dihydroisoindol-1-one;molecular hydrogen (CID 166478199) is 4-butan-2-yl-2,3-dihydroisoindol-1-one;molecular hydrogen.
What is the SMILES notation for 4-butan-2-yl-2,3-dihydroisoindol-1-one;molecular hydrogen?
The canonical SMILES for 4-butan-2-yl-2,3-dihydroisoindol-1-one;molecular hydrogen is CCC(C)c1cccc2c1CNC2=O.[H][H].
What is the InChIKey of 4-butan-2-yl-2,3-dihydroisoindol-1-one;molecular hydrogen?
The InChIKey is JTHOMGIZVHZHCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO.H2/c1-3-8(2)9-5-4-6-10-11(9)7-13-12(10)14;/h4-6,8H,3,7H2,1-2H3,(H,13,14);1H.
What are the key properties of 4-butan-2-yl-2,3-dihydroisoindol-1-one;molecular hydrogen?
4-butan-2-yl-2,3-dihydroisoindol-1-one;molecular hydrogen has a molecular weight of 191.27 g/mol, XLogP of 2.69, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-yl-2,3-dihydroisoindol-1-one;molecular hydrogen is sourced from PubChem (CID 166478199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).