About (5Z)-3,4-dimethyl-5-[tri(propan-2-yl)silylmethylidene]furan-2-one
(5Z)-3,4-dimethyl-5-[tri(propan-2-yl)silylmethylidene]furan-2-one (PubChem CID 166478872) has the molecular formula C16H28O2Si
and a molecular weight of 280.48 g/mol. Its IUPAC name is (5Z)-3,4-dimethyl-5-[tri(propan-2-yl)silylmethylidene]furan-2-one.
Molecular Properties
| Compound Name | (5Z)-3,4-dimethyl-5-[tri(propan-2-yl)silylmethylidene]furan-2-one |
| PubChem CID | 166478872 |
| Molecular Formula | C16H28O2Si |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | (5Z)-3,4-dimethyl-5-[tri(propan-2-yl)silylmethylidene]furan-2-one |
| SMILES | CC1=C(C)/C(=C/[Si](C(C)C)(C(C)C)C(C)C)OC1=O |
| InChI | InChI=1S/C16H28O2Si/c1-10(2)19(11(3)4,12(5)6)9-15-13(7)14(8)16(17)18-15/h9-12H,1-8H3/b15-9- |
| InChIKey | IAIOOPPRUDLDCA-DHDCSXOGSA-N |
| XLogP | 4.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-3,4-dimethyl-5-[tri(propan-2-yl)silylmethylidene]furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-3,4-dimethyl-5-[tri(propan-2-yl)silylmethylidene]furan-2-one?
The IUPAC name of (5Z)-3,4-dimethyl-5-[tri(propan-2-yl)silylmethylidene]furan-2-one (CID 166478872) is (5Z)-3,4-dimethyl-5-[tri(propan-2-yl)silylmethylidene]furan-2-one.
What is the SMILES notation for (5Z)-3,4-dimethyl-5-[tri(propan-2-yl)silylmethylidene]furan-2-one?
The canonical SMILES for (5Z)-3,4-dimethyl-5-[tri(propan-2-yl)silylmethylidene]furan-2-one is CC1=C(C)/C(=C/[Si](C(C)C)(C(C)C)C(C)C)OC1=O.
What is the InChIKey of (5Z)-3,4-dimethyl-5-[tri(propan-2-yl)silylmethylidene]furan-2-one?
The InChIKey is IAIOOPPRUDLDCA-DHDCSXOGSA-N. The full InChI is InChI=1S/C16H28O2Si/c1-10(2)19(11(3)4,12(5)6)9-15-13(7)14(8)16(17)18-15/h9-12H,1-8H3/b15-9-.
What are the key properties of (5Z)-3,4-dimethyl-5-[tri(propan-2-yl)silylmethylidene]furan-2-one?
(5Z)-3,4-dimethyl-5-[tri(propan-2-yl)silylmethylidene]furan-2-one has a molecular weight of 280.48 g/mol, XLogP of 4.98, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-3,4-dimethyl-5-[tri(propan-2-yl)silylmethylidene]furan-2-one is sourced from PubChem (CID 166478872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).