C14H17F4NO4 — CID 166479446
(2,3,4,5-tetrafluoro-6-methylphenyl) 3-[2-(2-aminoethoxy)ethoxy]propanoate (PubChem CID 166479446) has the molecular formula C14H17F4NO4 and a molecular weight of 339.29 g/mol. Its IUPAC name is (2,3,4,5-tetrafluoro-6-methylphenyl) 3-[2-(2-aminoethoxy)ethoxy]propanoate.
| Compound Name | (2,3,4,5-tetrafluoro-6-methylphenyl) 3-[2-(2-aminoethoxy)ethoxy]propanoate |
|---|---|
| PubChem CID | 166479446 |
| Molecular Formula | C14H17F4NO4 |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (2,3,4,5-tetrafluoro-6-methylphenyl) 3-[2-(2-aminoethoxy)ethoxy]propanoate |
| SMILES | Cc1c(F)c(F)c(F)c(F)c1OC(=O)CCOCCOCCN |
| InChI | InChI=1S/C14H17F4NO4/c1-8-10(15)11(16)12(17)13(18)14(8)23-9(20)2-4-21-6-7-22-5-3-19/h2-7,19H2,1H3 |
| InChIKey | WCYPJQHOTFLTAK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|