C25H23NO12 — CID 166479583
[(2R,3R)-7-(ethylcarbamoyloxy)-5-hydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate (PubChem CID 166479583) has the molecular formula C25H23NO12 and a molecular weight of 529.45 g/mol. Its IUPAC name is [(2R,3R)-7-(ethylcarbamoyloxy)-5-hydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [(2R,3R)-7-(ethylcarbamoyloxy)-5-hydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 166479583 |
| Molecular Formula | C25H23NO12 |
| Molecular Weight | 529.45 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | [(2R,3R)-7-(ethylcarbamoyloxy)-5-hydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
| SMILES | CCNC(=O)Oc1cc(O)c2c(c1)O[C@H](c1cc(O)c(O)c(O)c1)[C@H](OC(=O)c1cc(O)c(O)c(O)c1)C2 |
| InChI | InChI=1S/C25H23NO12/c1-2-26-25(35)36-12-7-14(27)13-9-20(38-24(34)11-5-17(30)22(33)18(31)6-11)23(37-19(13)8-12)10-3-15(28)21(32)16(29)4-10/h3-8,20,23,27-33H,2,9H2,1H3,(H,26,35)/t20-,23-/m1/s1 |
| InChIKey | IXBIZPYHDZMIIG-NFBKMPQASA-N |
| XLogP | 2.64 |
| TPSA | 215.47 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|