C28H38 — CID 166479860
ethane;(1S,3R)-1-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-3-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 166479860) has the molecular formula C28H38 and a molecular weight of 374.61 g/mol. Its IUPAC name is ethane;(1S,3R)-1-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-3-methyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | ethane;(1S,3R)-1-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-3-methyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 166479860 |
| Molecular Formula | C28H38 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.30 |
| IUPAC Name | ethane;(1S,3R)-1-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phenyl]-3-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | C=C/C=C(\C=C/C)c1cccc([C@@H]2C[C@@H](C)Cc3ccccc32)c1.CC.CC |
| InChI | InChI=1S/C24H26.2C2H6/c1-4-9-19(10-5-2)20-12-8-13-22(17-20)24-16-18(3)15-21-11-6-7-14-23(21)24;2*1-2/h4-14,17-18,24H,1,15-16H2,2-3H3;2*1-2H3/b10-5-,19-9+;;/t18-,24-;;/m0../s1 |
| InChIKey | VSYNSDIZAABHRL-FTMVOHFXSA-N |
| XLogP | 8.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|