C12H21NO7S — CID 166480175
methyl 3-[(2S,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropanoate (PubChem CID 166480175) has the molecular formula C12H21NO7S and a molecular weight of 323.37 g/mol. Its IUPAC name is methyl 3-[(2S,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropanoate.
| Compound Name | methyl 3-[(2S,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropanoate |
|---|---|
| PubChem CID | 166480175 |
| Molecular Formula | C12H21NO7S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | methyl 3-[(2S,3R,4R,5R,6R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpropanoate |
| SMILES | COC(=O)CCS[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C12H21NO7S/c1-6(15)13-9-11(18)10(17)7(5-14)20-12(9)21-4-3-8(16)19-2/h7,9-12,14,17-18H,3-5H2,1-2H3,(H,13,15)/t7-,9-,10+,11-,12+/m1/s1 |
| InChIKey | GMEGCJDETZNAJT-URYVQPGZSA-N |
| XLogP | -1.77 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |