C25H27F3N2O3 — CID 166480436
(2Z)-6,7-dihydroxy-3-oxo-2-[2,2,2-trifluoro-1-[6-(2-methylpiperidin-1-yl)naphthalen-2-yl]ethylidene]heptanenitrile (PubChem CID 166480436) has the molecular formula C25H27F3N2O3 and a molecular weight of 460.50 g/mol. Its IUPAC name is (2Z)-6,7-dihydroxy-3-oxo-2-[2,2,2-trifluoro-1-[6-(2-methylpiperidin-1-yl)naphthalen-2-yl]ethylidene]heptanenitrile.
| Compound Name | (2Z)-6,7-dihydroxy-3-oxo-2-[2,2,2-trifluoro-1-[6-(2-methylpiperidin-1-yl)naphthalen-2-yl]ethylidene]heptanenitrile |
|---|---|
| PubChem CID | 166480436 |
| Molecular Formula | C25H27F3N2O3 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | (2Z)-6,7-dihydroxy-3-oxo-2-[2,2,2-trifluoro-1-[6-(2-methylpiperidin-1-yl)naphthalen-2-yl]ethylidene]heptanenitrile |
| SMILES | CC1CCCCN1c1ccc2cc(/C(=C(\C#N)C(=O)CCC(O)CO)C(F)(F)F)ccc2c1 |
| InChI | InChI=1S/C25H27F3N2O3/c1-16-4-2-3-11-30(16)20-8-7-17-12-19(6-5-18(17)13-20)24(25(26,27)28)22(14-29)23(33)10-9-21(32)15-31/h5-8,12-13,16,21,31-32H,2-4,9-11,15H2,1H3/b24-22- |
| InChIKey | QFYMYGOTGMWUTO-GYHWCHFESA-N |
| XLogP | 4.76 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|