C22H25N3O3 — CID 166480439
(E)-2-cyano-N-(2,3-dihydroxypropyl)-3-(8-pyrrolidin-1-ylnaphthalen-2-yl)but-2-enamide (PubChem CID 166480439) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,3-dihydroxypropyl)-3-(8-pyrrolidin-1-ylnaphthalen-2-yl)but-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,3-dihydroxypropyl)-3-(8-pyrrolidin-1-ylnaphthalen-2-yl)but-2-enamide |
|---|---|
| PubChem CID | 166480439 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | (E)-2-cyano-N-(2,3-dihydroxypropyl)-3-(8-pyrrolidin-1-ylnaphthalen-2-yl)but-2-enamide |
| SMILES | C/C(=C(/C#N)C(=O)NCC(O)CO)c1ccc2cccc(N3CCCC3)c2c1 |
| InChI | InChI=1S/C22H25N3O3/c1-15(20(12-23)22(28)24-13-18(27)14-26)17-8-7-16-5-4-6-21(19(16)11-17)25-9-2-3-10-25/h4-8,11,18,26-27H,2-3,9-10,13-14H2,1H3,(H,24,28)/b20-15+ |
| InChIKey | VYXMJVFDWKJNKX-HMMYKYKNSA-N |
| XLogP | 2.21 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|