C25H40O5 — CID 166480853
ethane;4-(11-hydroxy-10,13-dimethyl-3,7-dioxo-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanoic acid (PubChem CID 166480853) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is ethane;4-(11-hydroxy-10,13-dimethyl-3,7-dioxo-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanoic acid.
| Compound Name | ethane;4-(11-hydroxy-10,13-dimethyl-3,7-dioxo-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanoic acid |
|---|---|
| PubChem CID | 166480853 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | ethane;4-(11-hydroxy-10,13-dimethyl-3,7-dioxo-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)butanoic acid |
| SMILES | CC.CC12CC(O)C3C(C(=O)CC4CC(=O)CCC43C)C1CCC2CCCC(=O)O |
| InChI | InChI=1S/C23H34O5.C2H6/c1-22-9-8-15(24)10-14(22)11-17(25)20-16-7-6-13(4-3-5-19(27)28)23(16,2)12-18(26)21(20)22;1-2/h13-14,16,18,20-21,26H,3-12H2,1-2H3,(H,27,28);1-2H3 |
| InChIKey | FSQLNHOQHQTUBO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |