About N-cyclohexyl-6-imidazol-1-ylpyrazine-2-carboxamide;methanol;molecular hydrogen
N-cyclohexyl-6-imidazol-1-ylpyrazine-2-carboxamide;methanol;molecular hydrogen (PubChem CID 166481102) has the molecular formula C15H23N5O2
and a molecular weight of 305.38 g/mol. Its IUPAC name is N-cyclohexyl-6-imidazol-1-ylpyrazine-2-carboxamide;methanol;molecular hydrogen.
Molecular Properties
| Compound Name | N-cyclohexyl-6-imidazol-1-ylpyrazine-2-carboxamide;methanol;molecular hydrogen |
| PubChem CID | 166481102 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | N-cyclohexyl-6-imidazol-1-ylpyrazine-2-carboxamide;methanol;molecular hydrogen |
| SMILES | CO.O=C(NC1CCCCC1)c1cncc(-n2ccnc2)n1.[H][H] |
| InChI | InChI=1S/C14H17N5O.CH4O.H2/c20-14(17-11-4-2-1-3-5-11)12-8-16-9-13(18-12)19-7-6-15-10-19;1-2;/h6-11H,1-5H2,(H,17,20);2H,1H3;1H |
| InChIKey | IARJXIANHRMIDY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-cyclohexyl-6-imidazol-1-ylpyrazine-2-carboxamide;methanol;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-6-imidazol-1-ylpyrazine-2-carboxamide;methanol;molecular hydrogen?
The IUPAC name of N-cyclohexyl-6-imidazol-1-ylpyrazine-2-carboxamide;methanol;molecular hydrogen (CID 166481102) is N-cyclohexyl-6-imidazol-1-ylpyrazine-2-carboxamide;methanol;molecular hydrogen.
What is the SMILES notation for N-cyclohexyl-6-imidazol-1-ylpyrazine-2-carboxamide;methanol;molecular hydrogen?
The canonical SMILES for N-cyclohexyl-6-imidazol-1-ylpyrazine-2-carboxamide;methanol;molecular hydrogen is CO.O=C(NC1CCCCC1)c1cncc(-n2ccnc2)n1.[H][H].
What is the InChIKey of N-cyclohexyl-6-imidazol-1-ylpyrazine-2-carboxamide;methanol;molecular hydrogen?
The InChIKey is IARJXIANHRMIDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5O.CH4O.H2/c20-14(17-11-4-2-1-3-5-11)12-8-16-9-13(18-12)19-7-6-15-10-19;1-2;/h6-11H,1-5H2,(H,17,20);2H,1H3;1H.
What are the key properties of N-cyclohexyl-6-imidazol-1-ylpyrazine-2-carboxamide;methanol;molecular hydrogen?
N-cyclohexyl-6-imidazol-1-ylpyrazine-2-carboxamide;methanol;molecular hydrogen has a molecular weight of 305.38 g/mol, XLogP of 1.58, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-6-imidazol-1-ylpyrazine-2-carboxamide;methanol;molecular hydrogen is sourced from PubChem (CID 166481102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).