About N-(2,2-difluorospiro[3.3]heptan-6-yl)-6-imidazol-1-ylpyrazine-2-carboxamide;molecular hydrogen
N-(2,2-difluorospiro[3.3]heptan-6-yl)-6-imidazol-1-ylpyrazine-2-carboxamide;molecular hydrogen (PubChem CID 166481517) has the molecular formula C15H17F2N5O
and a molecular weight of 321.33 g/mol. Its IUPAC name is N-(2,2-difluorospiro[3.3]heptan-6-yl)-6-imidazol-1-ylpyrazine-2-carboxamide;molecular hydrogen.
Molecular Properties
| Compound Name | N-(2,2-difluorospiro[3.3]heptan-6-yl)-6-imidazol-1-ylpyrazine-2-carboxamide;molecular hydrogen |
| PubChem CID | 166481517 |
| Molecular Formula | C15H17F2N5O |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | N-(2,2-difluorospiro[3.3]heptan-6-yl)-6-imidazol-1-ylpyrazine-2-carboxamide;molecular hydrogen |
| SMILES | O=C(NC1CC2(C1)CC(F)(F)C2)c1cncc(-n2ccnc2)n1.[H][H] |
| InChI | InChI=1S/C15H15F2N5O.H2/c16-15(17)7-14(8-15)3-10(4-14)20-13(23)11-5-19-6-12(21-11)22-2-1-18-9-22;/h1-2,5-6,9-10H,3-4,7-8H2,(H,20,23);1H |
| InChIKey | CQNHXRDWFCAUGF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2,2-difluorospiro[3.3]heptan-6-yl)-6-imidazol-1-ylpyrazine-2-carboxamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluorospiro[3.3]heptan-6-yl)-6-imidazol-1-ylpyrazine-2-carboxamide;molecular hydrogen?
The IUPAC name of N-(2,2-difluorospiro[3.3]heptan-6-yl)-6-imidazol-1-ylpyrazine-2-carboxamide;molecular hydrogen (CID 166481517) is N-(2,2-difluorospiro[3.3]heptan-6-yl)-6-imidazol-1-ylpyrazine-2-carboxamide;molecular hydrogen.
What is the SMILES notation for N-(2,2-difluorospiro[3.3]heptan-6-yl)-6-imidazol-1-ylpyrazine-2-carboxamide;molecular hydrogen?
The canonical SMILES for N-(2,2-difluorospiro[3.3]heptan-6-yl)-6-imidazol-1-ylpyrazine-2-carboxamide;molecular hydrogen is O=C(NC1CC2(C1)CC(F)(F)C2)c1cncc(-n2ccnc2)n1.[H][H].
What is the InChIKey of N-(2,2-difluorospiro[3.3]heptan-6-yl)-6-imidazol-1-ylpyrazine-2-carboxamide;molecular hydrogen?
The InChIKey is CQNHXRDWFCAUGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F2N5O.H2/c16-15(17)7-14(8-15)3-10(4-14)20-13(23)11-5-19-6-12(21-11)22-2-1-18-9-22;/h1-2,5-6,9-10H,3-4,7-8H2,(H,20,23);1H.
What are the key properties of N-(2,2-difluorospiro[3.3]heptan-6-yl)-6-imidazol-1-ylpyrazine-2-carboxamide;molecular hydrogen?
N-(2,2-difluorospiro[3.3]heptan-6-yl)-6-imidazol-1-ylpyrazine-2-carboxamide;molecular hydrogen has a molecular weight of 321.33 g/mol, XLogP of 2.22, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluorospiro[3.3]heptan-6-yl)-6-imidazol-1-ylpyrazine-2-carboxamide;molecular hydrogen is sourced from PubChem (CID 166481517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).