C19H20N2O4 — CID 16648188
methyl (Z)-4-(benzylamino)-3-(4-methoxyanilino)-4-oxobut-2-enoate (PubChem CID 16648188) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is methyl (Z)-4-(benzylamino)-3-(4-methoxyanilino)-4-oxobut-2-enoate.
| Compound Name | methyl (Z)-4-(benzylamino)-3-(4-methoxyanilino)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 16648188 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | methyl (Z)-4-(benzylamino)-3-(4-methoxyanilino)-4-oxobut-2-enoate |
| SMILES | COC(=O)/C=C(\Nc1ccc(OC)cc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H20N2O4/c1-24-16-10-8-15(9-11-16)21-17(12-18(22)25-2)19(23)20-13-14-6-4-3-5-7-14/h3-12,21H,13H2,1-2H3,(H,20,23)/b17-12- |
| InChIKey | JAORRIVXFPLWMC-ATVHPVEESA-N |
| XLogP | 2.48 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|