C9H4F5NO — CID 166482233
3,5-difluoro-3-(trifluoromethyl)-1H-indol-2-one (PubChem CID 166482233) has the molecular formula C9H4F5NO and a molecular weight of 237.13 g/mol. Its IUPAC name is 3,5-difluoro-3-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | 3,5-difluoro-3-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 166482233 |
| Molecular Formula | C9H4F5NO |
| Molecular Weight | 237.13 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 3,5-difluoro-3-(trifluoromethyl)-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(F)cc2C1(F)C(F)(F)F |
| InChI | InChI=1S/C9H4F5NO/c10-4-1-2-6-5(3-4)8(11,7(16)15-6)9(12,13)14/h1-3H,(H,15,16) |
| InChIKey | DFNOSYUYEJQAFH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.13 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |