C23H15ClF5N7O2 — CID 166482989
(8S)-8-(2-chloro-5-fluorophenyl)-1-[[3-[3-fluoro-5-(trifluoromethyl)phenyl]oxiran-2-yl]amino]-3-(1H-1,2,4-triazol-5-yl)-7,8-dihydro-5H-imidazo[1,5-a]pyrazin-6-one (PubChem CID 166482989) has the molecular formula C23H15ClF5N7O2 and a molecular weight of 551.86 g/mol. Its IUPAC name is (8S)-8-(2-chloro-5-fluorophenyl)-1-[[3-[3-fluoro-5-(trifluoromethyl)phenyl]oxiran-2-yl]amino]-3-(1H-1,2,4-triazol-5-yl)-7,8-dihydro-5H-imidazo[1,5-a]pyrazin-6-one.
| Compound Name | (8S)-8-(2-chloro-5-fluorophenyl)-1-[[3-[3-fluoro-5-(trifluoromethyl)phenyl]oxiran-2-yl]amino]-3-(1H-1,2,4-triazol-5-yl)-7,8-dihydro-5H-imidazo[1,5-a]pyrazin-6-one |
|---|---|
| PubChem CID | 166482989 |
| Molecular Formula | C23H15ClF5N7O2 |
| Molecular Weight | 551.86 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | (8S)-8-(2-chloro-5-fluorophenyl)-1-[[3-[3-fluoro-5-(trifluoromethyl)phenyl]oxiran-2-yl]amino]-3-(1H-1,2,4-triazol-5-yl)-7,8-dihydro-5H-imidazo[1,5-a]pyrazin-6-one |
| SMILES | O=C1Cn2c(-c3ncn[nH]3)nc(NC3OC3c3cc(F)cc(C(F)(F)F)c3)c2[C@H](c2cc(F)ccc2Cl)N1 |
| InChI | InChI=1S/C23H15ClF5N7O2/c24-14-2-1-11(25)6-13(14)16-17-19(33-21(20-30-8-31-35-20)36(17)7-15(37)32-16)34-22-18(38-22)9-3-10(23(27,28)29)5-12(26)4-9/h1-6,8,16,18,22,34H,7H2,(H,32,37)(H,30,31,35)/t16-,18?,22?/m0/s1 |
| InChIKey | SBCNIENDHOVXKK-GENZYMQKSA-N |
| XLogP | 4.35 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.86 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|