C20H20N4O — CID 16648320
N-cyclopentyl-4-(5-phenyltriazol-1-yl)benzamide (PubChem CID 16648320) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is N-cyclopentyl-4-(5-phenyltriazol-1-yl)benzamide.
| Compound Name | N-cyclopentyl-4-(5-phenyltriazol-1-yl)benzamide |
|---|---|
| PubChem CID | 16648320 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | N-cyclopentyl-4-(5-phenyltriazol-1-yl)benzamide |
| SMILES | O=C(NC1CCCC1)c1ccc(-n2nncc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H20N4O/c25-20(22-17-8-4-5-9-17)16-10-12-18(13-11-16)24-19(14-21-23-24)15-6-2-1-3-7-15/h1-3,6-7,10-14,17H,4-5,8-9H2,(H,22,25) |
| InChIKey | ZXTAIXFMMHECTA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |