About 4-[4-(5-amino-1,2-oxazol-3-yl)piperidine-1-carbonyl]-2-chlorobenzonitrile
4-[4-(5-amino-1,2-oxazol-3-yl)piperidine-1-carbonyl]-2-chlorobenzonitrile (PubChem CID 166483342) has the molecular formula C16H15ClN4O2
and a molecular weight of 330.78 g/mol. Its IUPAC name is 4-[4-(5-amino-1,2-oxazol-3-yl)piperidine-1-carbonyl]-2-chlorobenzonitrile.
Molecular Properties
| Compound Name | 4-[4-(5-amino-1,2-oxazol-3-yl)piperidine-1-carbonyl]-2-chlorobenzonitrile |
| PubChem CID | 166483342 |
| Molecular Formula | C16H15ClN4O2 |
| Molecular Weight | 330.78 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 4-[4-(5-amino-1,2-oxazol-3-yl)piperidine-1-carbonyl]-2-chlorobenzonitrile |
| SMILES | N#Cc1ccc(C(=O)N2CCC(c3cc(N)on3)CC2)cc1Cl |
| InChI | InChI=1S/C16H15ClN4O2/c17-13-7-11(1-2-12(13)9-18)16(22)21-5-3-10(4-6-21)14-8-15(19)23-20-14/h1-2,7-8,10H,3-6,19H2 |
| InChIKey | PTJCGHAKBQTNEG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.78 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-(5-amino-1,2-oxazol-3-yl)piperidine-1-carbonyl]-2-chlorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(5-amino-1,2-oxazol-3-yl)piperidine-1-carbonyl]-2-chlorobenzonitrile?
The IUPAC name of 4-[4-(5-amino-1,2-oxazol-3-yl)piperidine-1-carbonyl]-2-chlorobenzonitrile (CID 166483342) is 4-[4-(5-amino-1,2-oxazol-3-yl)piperidine-1-carbonyl]-2-chlorobenzonitrile.
What is the SMILES notation for 4-[4-(5-amino-1,2-oxazol-3-yl)piperidine-1-carbonyl]-2-chlorobenzonitrile?
The canonical SMILES for 4-[4-(5-amino-1,2-oxazol-3-yl)piperidine-1-carbonyl]-2-chlorobenzonitrile is N#Cc1ccc(C(=O)N2CCC(c3cc(N)on3)CC2)cc1Cl.
What is the InChIKey of 4-[4-(5-amino-1,2-oxazol-3-yl)piperidine-1-carbonyl]-2-chlorobenzonitrile?
The InChIKey is PTJCGHAKBQTNEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClN4O2/c17-13-7-11(1-2-12(13)9-18)16(22)21-5-3-10(4-6-21)14-8-15(19)23-20-14/h1-2,7-8,10H,3-6,19H2.
What are the key properties of 4-[4-(5-amino-1,2-oxazol-3-yl)piperidine-1-carbonyl]-2-chlorobenzonitrile?
4-[4-(5-amino-1,2-oxazol-3-yl)piperidine-1-carbonyl]-2-chlorobenzonitrile has a molecular weight of 330.78 g/mol, XLogP of 2.80, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(5-amino-1,2-oxazol-3-yl)piperidine-1-carbonyl]-2-chlorobenzonitrile is sourced from PubChem (CID 166483342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).