C16H19ClF3N3OS — CID 166483412
2-[6-chloro-1-(1,1,1-trifluoro-4-methylsulfanylbutan-2-yl)oxy-2,7-naphthyridin-4-yl]propan-2-amine (PubChem CID 166483412) has the molecular formula C16H19ClF3N3OS and a molecular weight of 393.86 g/mol. Its IUPAC name is 2-[6-chloro-1-(1,1,1-trifluoro-4-methylsulfanylbutan-2-yl)oxy-2,7-naphthyridin-4-yl]propan-2-amine.
| Compound Name | 2-[6-chloro-1-(1,1,1-trifluoro-4-methylsulfanylbutan-2-yl)oxy-2,7-naphthyridin-4-yl]propan-2-amine |
|---|---|
| PubChem CID | 166483412 |
| Molecular Formula | C16H19ClF3N3OS |
| Molecular Weight | 393.86 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 2-[6-chloro-1-(1,1,1-trifluoro-4-methylsulfanylbutan-2-yl)oxy-2,7-naphthyridin-4-yl]propan-2-amine |
| SMILES | CSCCC(Oc1ncc(C(C)(C)N)c2cc(Cl)ncc12)C(F)(F)F |
| InChI | InChI=1S/C16H19ClF3N3OS/c1-15(2,21)11-8-23-14(10-7-22-13(17)6-9(10)11)24-12(4-5-25-3)16(18,19)20/h6-8,12H,4-5,21H2,1-3H3 |
| InChIKey | RPRNAGRYJXYULK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.86 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|