C16H17ClF3N5O3S — CID 166483720
4-(2-azidopropan-2-yl)-6-chloro-1-[(2R)-1,1,1-trifluoro-4-methylsulfonylbutan-2-yl]oxy-2,7-naphthyridine (PubChem CID 166483720) has the molecular formula C16H17ClF3N5O3S and a molecular weight of 451.86 g/mol. Its IUPAC name is 4-(2-azidopropan-2-yl)-6-chloro-1-[(2R)-1,1,1-trifluoro-4-methylsulfonylbutan-2-yl]oxy-2,7-naphthyridine.
| Compound Name | 4-(2-azidopropan-2-yl)-6-chloro-1-[(2R)-1,1,1-trifluoro-4-methylsulfonylbutan-2-yl]oxy-2,7-naphthyridine |
|---|---|
| PubChem CID | 166483720 |
| Molecular Formula | C16H17ClF3N5O3S |
| Molecular Weight | 451.86 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | 4-(2-azidopropan-2-yl)-6-chloro-1-[(2R)-1,1,1-trifluoro-4-methylsulfonylbutan-2-yl]oxy-2,7-naphthyridine |
| SMILES | CC(C)(N=[N+]=[N-])c1cnc(O[C@H](CCS(C)(=O)=O)C(F)(F)F)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C16H17ClF3N5O3S/c1-15(2,24-25-21)11-8-23-14(10-7-22-13(17)6-9(10)11)28-12(16(18,19)20)4-5-29(3,26)27/h6-8,12H,4-5H2,1-3H3/t12-/m1/s1 |
| InChIKey | UJOSHMUUMCNSOY-GFCCVEGCSA-N |
| XLogP | 4.57 |
| TPSA | 117.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.86 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|