C17H25ClN4O2S — CID 166483809
4-(2-aminopropan-2-yl)-6-chloro-2H-2,7-naphthyridin-1-one;N,N-dimethylcyclobutanesulfinamide (PubChem CID 166483809) has the molecular formula C17H25ClN4O2S and a molecular weight of 384.93 g/mol. Its IUPAC name is 4-(2-aminopropan-2-yl)-6-chloro-2H-2,7-naphthyridin-1-one;N,N-dimethylcyclobutanesulfinamide.
| Compound Name | 4-(2-aminopropan-2-yl)-6-chloro-2H-2,7-naphthyridin-1-one;N,N-dimethylcyclobutanesulfinamide |
|---|---|
| PubChem CID | 166483809 |
| Molecular Formula | C17H25ClN4O2S |
| Molecular Weight | 384.93 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 4-(2-aminopropan-2-yl)-6-chloro-2H-2,7-naphthyridin-1-one;N,N-dimethylcyclobutanesulfinamide |
| SMILES | CC(C)(N)c1c[nH]c(=O)c2cnc(Cl)cc12.CN(C)S(=O)C1CCC1 |
| InChI | InChI=1S/C11H12ClN3O.C6H13NOS/c1-11(2,13)8-5-15-10(16)7-4-14-9(12)3-6(7)8;1-7(2)9(8)6-4-3-5-6/h3-5H,13H2,1-2H3,(H,15,16);6H,3-5H2,1-2H3 |
| InChIKey | MWXONWUVLYMTRH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.93 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|