C16H17ClF3N5OS — CID 166483822
4-(2-azidopropan-2-yl)-6-chloro-1-(1,1,1-trifluoro-4-methylsulfanylbutan-2-yl)oxy-2,7-naphthyridine (PubChem CID 166483822) has the molecular formula C16H17ClF3N5OS and a molecular weight of 419.86 g/mol. Its IUPAC name is 4-(2-azidopropan-2-yl)-6-chloro-1-(1,1,1-trifluoro-4-methylsulfanylbutan-2-yl)oxy-2,7-naphthyridine.
| Compound Name | 4-(2-azidopropan-2-yl)-6-chloro-1-(1,1,1-trifluoro-4-methylsulfanylbutan-2-yl)oxy-2,7-naphthyridine |
|---|---|
| PubChem CID | 166483822 |
| Molecular Formula | C16H17ClF3N5OS |
| Molecular Weight | 419.86 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 4-(2-azidopropan-2-yl)-6-chloro-1-(1,1,1-trifluoro-4-methylsulfanylbutan-2-yl)oxy-2,7-naphthyridine |
| SMILES | CSCCC(Oc1ncc(C(C)(C)N=[N+]=[N-])c2cc(Cl)ncc12)C(F)(F)F |
| InChI | InChI=1S/C16H17ClF3N5OS/c1-15(2,24-25-21)11-8-23-14(10-7-22-13(17)6-9(10)11)26-12(4-5-27-3)16(18,19)20/h6-8,12H,4-5H2,1-3H3 |
| InChIKey | WHJHBQCWFHAYHV-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 83.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.86 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|