C29H39N5O3S — CID 166483873
(7S)-2-[[5-[(2R)-2-aminobutan-2-yl]-8-[(2R)-4-methylsulfanylpentan-2-yl]oxy-2,7-naphthyridin-3-yl]amino]-7,8,8-trimethyl-7H-pyrano[4,3-b]pyridin-5-one (PubChem CID 166483873) has the molecular formula C29H39N5O3S and a molecular weight of 537.73 g/mol. Its IUPAC name is (7S)-2-[[5-[(2R)-2-aminobutan-2-yl]-8-[(2R)-4-methylsulfanylpentan-2-yl]oxy-2,7-naphthyridin-3-yl]amino]-7,8,8-trimethyl-7H-pyrano[4,3-b]pyridin-5-one.
| Compound Name | (7S)-2-[[5-[(2R)-2-aminobutan-2-yl]-8-[(2R)-4-methylsulfanylpentan-2-yl]oxy-2,7-naphthyridin-3-yl]amino]-7,8,8-trimethyl-7H-pyrano[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 166483873 |
| Molecular Formula | C29H39N5O3S |
| Molecular Weight | 537.73 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | (7S)-2-[[5-[(2R)-2-aminobutan-2-yl]-8-[(2R)-4-methylsulfanylpentan-2-yl]oxy-2,7-naphthyridin-3-yl]amino]-7,8,8-trimethyl-7H-pyrano[4,3-b]pyridin-5-one |
| SMILES | CC[C@@](C)(N)c1cnc(O[C@H](C)CC(C)SC)c2cnc(Nc3ccc4c(n3)C(C)(C)[C@H](C)OC4=O)cc12 |
| InChI | InChI=1S/C29H39N5O3S/c1-9-29(7,30)22-15-32-26(36-16(2)12-17(3)38-8)21-14-31-24(13-20(21)22)33-23-11-10-19-25(34-23)28(5,6)18(4)37-27(19)35/h10-11,13-18H,9,12,30H2,1-8H3,(H,31,33,34)/t16-,17?,18+,29-/m1/s1 |
| InChIKey | UAFRAUSNLLCHDI-PZSQBZBZSA-N |
| XLogP | 6.10 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.73 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |