C18H25ClN6O2S — CID 166484081
[(2R,4R)-4-[[4-[(2R)-2-azidobutan-2-yl]-6-chloro-2,7-naphthyridin-1-yl]oxy]pentan-2-yl]-imino-methyl-oxo-λ6-sulfane (PubChem CID 166484081) has the molecular formula C18H25ClN6O2S and a molecular weight of 424.96 g/mol. Its IUPAC name is [(2R,4R)-4-[[4-[(2R)-2-azidobutan-2-yl]-6-chloro-2,7-naphthyridin-1-yl]oxy]pentan-2-yl]-imino-methyl-oxo-λ6-sulfane.
| Compound Name | [(2R,4R)-4-[[4-[(2R)-2-azidobutan-2-yl]-6-chloro-2,7-naphthyridin-1-yl]oxy]pentan-2-yl]-imino-methyl-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 166484081 |
| Molecular Formula | C18H25ClN6O2S |
| Molecular Weight | 424.96 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | [(2R,4R)-4-[[4-[(2R)-2-azidobutan-2-yl]-6-chloro-2,7-naphthyridin-1-yl]oxy]pentan-2-yl]-imino-methyl-oxo-λ6-sulfane |
| SMILES | [H]N=[S@@](C)(=O)[C@H](C)C[C@@H](C)Oc1ncc([C@@](C)(CC)N=[N+]=[N-])c2cc(Cl)ncc12 |
| InChI | InChI=1S/C18H25ClN6O2S/c1-6-18(4,24-25-20)15-10-23-17(14-9-22-16(19)8-13(14)15)27-11(2)7-12(3)28(5,21)26/h8-12,21H,6-7H2,1-5H3/t11-,12-,18-,28+/m1/s1 |
| InChIKey | IIPXRGXBWUHHGB-JREMXKSZSA-N |
| XLogP | 5.44 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.96 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|