About 4-bromo-6-chloro-1-(2,2-difluoroethoxy)-2,7-naphthyridine
4-bromo-6-chloro-1-(2,2-difluoroethoxy)-2,7-naphthyridine (PubChem CID 166484182) has the molecular formula C10H6BrClF2N2O
and a molecular weight of 323.52 g/mol. Its IUPAC name is 4-bromo-6-chloro-1-(2,2-difluoroethoxy)-2,7-naphthyridine.
Molecular Properties
| Compound Name | 4-bromo-6-chloro-1-(2,2-difluoroethoxy)-2,7-naphthyridine |
| PubChem CID | 166484182 |
| Molecular Formula | C10H6BrClF2N2O |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 321.93 |
| IUPAC Name | 4-bromo-6-chloro-1-(2,2-difluoroethoxy)-2,7-naphthyridine |
| SMILES | FC(F)COc1ncc(Br)c2cc(Cl)ncc12 |
| InChI | InChI=1S/C10H6BrClF2N2O/c11-7-3-16-10(17-4-9(13)14)6-2-15-8(12)1-5(6)7/h1-3,9H,4H2 |
| InChIKey | GZZYDJMZFISZTM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-6-chloro-1-(2,2-difluoroethoxy)-2,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-6-chloro-1-(2,2-difluoroethoxy)-2,7-naphthyridine?
The IUPAC name of 4-bromo-6-chloro-1-(2,2-difluoroethoxy)-2,7-naphthyridine (CID 166484182) is 4-bromo-6-chloro-1-(2,2-difluoroethoxy)-2,7-naphthyridine.
What is the SMILES notation for 4-bromo-6-chloro-1-(2,2-difluoroethoxy)-2,7-naphthyridine?
The canonical SMILES for 4-bromo-6-chloro-1-(2,2-difluoroethoxy)-2,7-naphthyridine is FC(F)COc1ncc(Br)c2cc(Cl)ncc12.
What is the InChIKey of 4-bromo-6-chloro-1-(2,2-difluoroethoxy)-2,7-naphthyridine?
The InChIKey is GZZYDJMZFISZTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6BrClF2N2O/c11-7-3-16-10(17-4-9(13)14)6-2-15-8(12)1-5(6)7/h1-3,9H,4H2.
What are the key properties of 4-bromo-6-chloro-1-(2,2-difluoroethoxy)-2,7-naphthyridine?
4-bromo-6-chloro-1-(2,2-difluoroethoxy)-2,7-naphthyridine has a molecular weight of 323.52 g/mol, XLogP of 3.69, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-6-chloro-1-(2,2-difluoroethoxy)-2,7-naphthyridine is sourced from PubChem (CID 166484182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).