C26H33FO3Si — CID 166484621
methyl 5-[tert-butyl(diphenyl)silyl]oxy-1-fluoro-3,3a,4,5,6,6a-hexahydro-2H-pentalene-1-carboxylate (PubChem CID 166484621) has the molecular formula C26H33FO3Si and a molecular weight of 440.63 g/mol. Its IUPAC name is methyl 5-[tert-butyl(diphenyl)silyl]oxy-1-fluoro-3,3a,4,5,6,6a-hexahydro-2H-pentalene-1-carboxylate.
| Compound Name | methyl 5-[tert-butyl(diphenyl)silyl]oxy-1-fluoro-3,3a,4,5,6,6a-hexahydro-2H-pentalene-1-carboxylate |
|---|---|
| PubChem CID | 166484621 |
| Molecular Formula | C26H33FO3Si |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | methyl 5-[tert-butyl(diphenyl)silyl]oxy-1-fluoro-3,3a,4,5,6,6a-hexahydro-2H-pentalene-1-carboxylate |
| SMILES | COC(=O)C1(F)CCC2CC(O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CC21 |
| InChI | InChI=1S/C26H33FO3Si/c1-25(2,3)31(21-11-7-5-8-12-21,22-13-9-6-10-14-22)30-20-17-19-15-16-26(27,23(19)18-20)24(28)29-4/h5-14,19-20,23H,15-18H2,1-4H3 |
| InChIKey | JKEGAIVMKTZTDF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|